C15H21NO5S — CID 94006317
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(2-ethoxyphenoxy)acetamide (PubChem CID 94006317) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 94006317 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)NC[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO5S/c1-2-20-13-5-3-4-6-14(13)21-10-15(17)16-9-12-7-8-22(18,19)11-12/h3-6,12H,2,7-11H2,1H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | KNUOQPUFQDVDSX-GFCCVEGCSA-N |
| XLogP | 1.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |