C13H25N3O3S — CID 117235156
1-(azepan-3-yl)-3-[(1,1-dioxothian-3-yl)methyl]urea (PubChem CID 117235156) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(azepan-3-yl)-3-[(1,1-dioxothian-3-yl)methyl]urea.
| Compound Name | 1-(azepan-3-yl)-3-[(1,1-dioxothian-3-yl)methyl]urea |
|---|---|
| PubChem CID | 117235156 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(azepan-3-yl)-3-[(1,1-dioxothian-3-yl)methyl]urea |
| SMILES | O=C(NCC1CCCS(=O)(=O)C1)NC1CCCCNC1 |
| InChI | InChI=1S/C13H25N3O3S/c17-13(16-12-5-1-2-6-14-9-12)15-8-11-4-3-7-20(18,19)10-11/h11-12,14H,1-10H2,(H2,15,16,17) |
| InChIKey | VBKVRZMIYHJRRZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |