C12H23N3O3S — CID 117235073
1-[(1,1-dioxothian-2-yl)methyl]-3-piperidin-3-ylurea (PubChem CID 117235073) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-2-yl)methyl]-3-piperidin-3-ylurea.
| Compound Name | 1-[(1,1-dioxothian-2-yl)methyl]-3-piperidin-3-ylurea |
|---|---|
| PubChem CID | 117235073 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(1,1-dioxothian-2-yl)methyl]-3-piperidin-3-ylurea |
| SMILES | O=C(NCC1CCCCS1(=O)=O)NC1CCCNC1 |
| InChI | InChI=1S/C12H23N3O3S/c16-12(15-10-4-3-6-13-8-10)14-9-11-5-1-2-7-19(11,17)18/h10-11,13H,1-9H2,(H2,14,15,16) |
| InChIKey | OSWQSQITJIBHQH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |