C9H18N2O2S — CID 81039653
N-[(1,1-dioxothiolan-2-yl)methyl]pyrrolidin-3-amine (PubChem CID 81039653) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]pyrrolidin-3-amine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 81039653 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]pyrrolidin-3-amine |
| SMILES | O=S1(=O)CCCC1CNC1CCNC1 |
| InChI | InChI=1S/C9H18N2O2S/c12-14(13)5-1-2-9(14)7-11-8-3-4-10-6-8/h8-11H,1-7H2 |
| InChIKey | LVLIBXLDNSHZEW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |