C12H23NO2S2 — CID 81039272
N-[(1,1-dioxothiolan-2-yl)methyl]-5,5-dimethylthian-3-amine (PubChem CID 81039272) has the molecular formula C12H23NO2S2 and a molecular weight of 277.45 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-5,5-dimethylthian-3-amine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 81039272 |
| Molecular Formula | C12H23NO2S2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(NCC2CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C12H23NO2S2/c1-12(2)6-10(8-16-9-12)13-7-11-4-3-5-17(11,14)15/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | ALRIRHSHIWQIDA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |