C12H23NS — CID 79956232
N-(cyclobutylmethyl)-5,5-dimethylthian-3-amine (PubChem CID 79956232) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-5,5-dimethylthian-3-amine.
| Compound Name | N-(cyclobutylmethyl)-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79956232 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-(cyclobutylmethyl)-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(NCC2CCC2)C1 |
| InChI | InChI=1S/C12H23NS/c1-12(2)6-11(8-14-9-12)13-7-10-4-3-5-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | YMYUUPCCGRZVGA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |