C11H21NO3S — CID 81039147
N-[(1,1-dioxothiolan-2-yl)methyl]oxepan-4-amine (PubChem CID 81039147) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]oxepan-4-amine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]oxepan-4-amine |
|---|---|
| PubChem CID | 81039147 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]oxepan-4-amine |
| SMILES | O=S1(=O)CCCC1CNC1CCCOCC1 |
| InChI | InChI=1S/C11H21NO3S/c13-16(14)8-2-4-11(16)9-12-10-3-1-6-15-7-5-10/h10-12H,1-9H2 |
| InChIKey | BFGKEUIIPLHVSA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |