C11H21NO3 — CID 65081559
N-(1,4-dioxan-2-ylmethyl)oxepan-4-amine (PubChem CID 65081559) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)oxepan-4-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)oxepan-4-amine |
|---|---|
| PubChem CID | 65081559 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)oxepan-4-amine |
| SMILES | C1COCCC(NCC2COCCO2)C1 |
| InChI | InChI=1S/C11H21NO3/c1-2-10(3-5-13-4-1)12-8-11-9-14-6-7-15-11/h10-12H,1-9H2 |
| InChIKey | BRGAUHJQYRZBOK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |