C11H21N3O3S — CID 117234755
1-(1,1-dioxothian-3-yl)-3-(pyrrolidin-2-ylmethyl)urea (PubChem CID 117234755) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-3-(pyrrolidin-2-ylmethyl)urea.
| Compound Name | 1-(1,1-dioxothian-3-yl)-3-(pyrrolidin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 117234755 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-3-(pyrrolidin-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCCN1)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21N3O3S/c15-11(13-7-9-3-1-5-12-9)14-10-4-2-6-18(16,17)8-10/h9-10,12H,1-8H2,(H2,13,14,15) |
| InChIKey | VGDKXFPDKFYTLU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |