C10H18N2O6S — CID 79463569
2-[2-[(1,1-dioxothian-3-yl)carbamoylamino]ethoxy]acetic acid (PubChem CID 79463569) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothian-3-yl)carbamoylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(1,1-dioxothian-3-yl)carbamoylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463569 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[2-[(1,1-dioxothian-3-yl)carbamoylamino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O6S/c13-9(14)6-18-4-3-11-10(15)12-8-2-1-5-19(16,17)7-8/h8H,1-7H2,(H,13,14)(H2,11,12,15) |
| InChIKey | JYJHJDOLNIMWDW-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|