C13H24N2O3S — CID 110748171
1-cyclohexyl-3-[2-(1,1-dioxothiolan-3-yl)ethyl]urea (PubChem CID 110748171) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(1,1-dioxothiolan-3-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(1,1-dioxothiolan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 110748171 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-cyclohexyl-3-[2-(1,1-dioxothiolan-3-yl)ethyl]urea |
| SMILES | O=C(NCCC1CCS(=O)(=O)C1)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O3S/c16-13(15-12-4-2-1-3-5-12)14-8-6-11-7-9-19(17,18)10-11/h11-12H,1-10H2,(H2,14,15,16) |
| InChIKey | WYVNULIICRLSDS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |