C15H27NO3S — CID 110419542
2-cyclopentyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide (PubChem CID 110419542) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide.
| Compound Name | 2-cyclopentyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 110419542 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-cyclopentyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide |
| SMILES | CC(C(=O)NCCCC1CCS(=O)(=O)C1)C1CCCC1 |
| InChI | InChI=1S/C15H27NO3S/c1-12(14-6-2-3-7-14)15(17)16-9-4-5-13-8-10-20(18,19)11-13/h12-14H,2-11H2,1H3,(H,16,17) |
| InChIKey | JILXNNFIFFIDDT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|