C10H22N2O4S2 — CID 110610699
3-(1,1-dioxothiolan-3-yl)-N-(propan-2-ylsulfamoyl)propan-1-amine (PubChem CID 110610699) has the molecular formula C10H22N2O4S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-N-(propan-2-ylsulfamoyl)propan-1-amine.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-N-(propan-2-ylsulfamoyl)propan-1-amine |
|---|---|
| PubChem CID | 110610699 |
| Molecular Formula | C10H22N2O4S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-N-(propan-2-ylsulfamoyl)propan-1-amine |
| SMILES | CC(C)NS(=O)(=O)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H22N2O4S2/c1-9(2)12-18(15,16)11-6-3-4-10-5-7-17(13,14)8-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | WODXMYRYDDSNNR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|