C15H23NO6S2 — CID 110603011
N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 110603011) has the molecular formula C15H23NO6S2 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110603011 |
| Molecular Formula | C15H23NO6S2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H23NO6S2/c1-21-13-5-6-14(22-2)15(10-13)24(19,20)16-8-3-4-12-7-9-23(17,18)11-12/h5-6,10,12,16H,3-4,7-9,11H2,1-2H3 |
| InChIKey | KNNHALPWWBOIEO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|