C16H23NO4S2 — CID 110419004
N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 110419004) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 110419004 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S1(=O)CCC(CCCNS(=O)(=O)c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C16H23NO4S2/c18-22(19)10-8-13(12-22)3-2-9-17-23(20,21)16-7-6-14-4-1-5-15(14)11-16/h6-7,11,13,17H,1-5,8-10,12H2 |
| InChIKey | AIUUJFLSQYQPCE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|