C13H17NO6S2 — CID 110723028
4-[2-(1,1-dioxothiolan-3-yl)ethylsulfamoyl]benzoic acid (PubChem CID 110723028) has the molecular formula C13H17NO6S2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-[2-(1,1-dioxothiolan-3-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-[2-(1,1-dioxothiolan-3-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 110723028 |
| Molecular Formula | C13H17NO6S2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-[2-(1,1-dioxothiolan-3-yl)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO6S2/c15-13(16)11-1-3-12(4-2-11)22(19,20)14-7-5-10-6-8-21(17,18)9-10/h1-4,10,14H,5-9H2,(H,15,16) |
| InChIKey | IEOSFWLRCYTBGP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |