C15H23NO4S2 — CID 110603003
N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 110603003) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110603003 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H23NO4S2/c1-12-5-6-13(2)15(10-12)22(19,20)16-8-3-4-14-7-9-21(17,18)11-14/h5-6,10,14,16H,3-4,7-9,11H2,1-2H3 |
| InChIKey | BLAZLVNGJSYRLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|