C14H20ClNO4S2 — CID 110603018
1-(2-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]methanesulfonamide (PubChem CID 110603018) has the molecular formula C14H20ClNO4S2 and a molecular weight of 365.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 110603018 |
| Molecular Formula | C14H20ClNO4S2 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]methanesulfonamide |
| SMILES | O=S1(=O)CCC(CCCNS(=O)(=O)Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C14H20ClNO4S2/c15-14-6-2-1-5-13(14)11-22(19,20)16-8-3-4-12-7-9-21(17,18)10-12/h1-2,5-6,12,16H,3-4,7-11H2 |
| InChIKey | CVBAKOJLWXEKRE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|