C13H18ClNO2S — CID 90100839
N-[(2-chlorophenyl)methyl]-2-(1,1-dioxothiolan-3-yl)ethanamine (PubChem CID 90100839) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(1,1-dioxothiolan-3-yl)ethanamine.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(1,1-dioxothiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 90100839 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(1,1-dioxothiolan-3-yl)ethanamine |
| SMILES | O=S1(=O)CCC(CCNCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C13H18ClNO2S/c14-13-4-2-1-3-12(13)9-15-7-5-11-6-8-18(16,17)10-11/h1-4,11,15H,5-10H2 |
| InChIKey | RQGIAFOVBAIHFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|