C14H18FNO3S — CID 110722984
N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 110722984) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110722984 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)NCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18FNO3S/c15-13-4-2-1-3-12(13)9-14(17)16-7-5-11-6-8-20(18,19)10-11/h1-4,11H,5-10H2,(H,16,17) |
| InChIKey | WGPXDQYIAWGULM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |