C17H22FNO3S — CID 110419576
N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 110419576) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110419576 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H22FNO3S/c18-15-6-2-1-5-14(15)17(8-9-17)16(20)19-10-3-4-13-7-11-23(21,22)12-13/h1-2,5-6,13H,3-4,7-12H2,(H,19,20) |
| InChIKey | KWXQEDCVJGJZAD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|