C16H22FNO2 — CID 110438277
1-(2-fluorophenyl)-N-(3-methoxypropyl)cyclopentane-1-carboxamide (PubChem CID 110438277) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(3-methoxypropyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(3-methoxypropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110438277 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(3-methoxypropyl)cyclopentane-1-carboxamide |
| SMILES | COCCCNC(=O)C1(c2ccccc2F)CCCC1 |
| InChI | InChI=1S/C16H22FNO2/c1-20-12-6-11-18-15(19)16(9-4-5-10-16)13-7-2-3-8-14(13)17/h2-3,7-8H,4-6,9-12H2,1H3,(H,18,19) |
| InChIKey | LENTZXWWNXNQLG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|