C21H24FNO2 — CID 60543655
1-(2-fluorophenyl)-N-(2-methoxy-2-phenylethyl)cyclopentane-1-carboxamide (PubChem CID 60543655) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-methoxy-2-phenylethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(2-methoxy-2-phenylethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 60543655 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-methoxy-2-phenylethyl)cyclopentane-1-carboxamide |
| SMILES | COC(CNC(=O)C1(c2ccccc2F)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H24FNO2/c1-25-19(16-9-3-2-4-10-16)15-23-20(24)21(13-7-8-14-21)17-11-5-6-12-18(17)22/h2-6,9-12,19H,7-8,13-15H2,1H3,(H,23,24) |
| InChIKey | YMMCEGLAVDLWIN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |