C16H24ClFN2O2 — CID 119343019
1-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119343019) has the molecular formula C16H24ClFN2O2 and a molecular weight of 330.83 g/mol. Its IUPAC name is 1-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119343019 |
| Molecular Formula | C16H24ClFN2O2 |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COC(CNC(=O)C1(N)CCCCC1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C16H23FN2O2.ClH/c1-21-14(12-5-7-13(17)8-6-12)11-19-15(20)16(18)9-3-2-4-10-16;/h5-8,14H,2-4,9-11,18H2,1H3,(H,19,20);1H |
| InChIKey | HOGCXKWLSYVLBQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |