C13H20ClFN2O3 — CID 120991420
2-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120991420) has the molecular formula C13H20ClFN2O3 and a molecular weight of 306.77 g/mol. Its IUPAC name is 2-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120991420 |
| Molecular Formula | C13H20ClFN2O3 |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-amino-N-[2-(4-fluorophenyl)-2-methoxyethyl]-3-methoxypropanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NCC(OC)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C13H19FN2O3.ClH/c1-18-8-11(15)13(17)16-7-12(19-2)9-3-5-10(14)6-4-9;/h3-6,11-12H,7-8,15H2,1-2H3,(H,16,17);1H |
| InChIKey | VVLCIPGYEINCHY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |