C15H21NO4S — CID 110418906
N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-phenoxyacetamide (PubChem CID 110418906) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-phenoxyacetamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 110418906 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO4S/c17-15(11-20-14-6-2-1-3-7-14)16-9-4-5-13-8-10-21(18,19)12-13/h1-3,6-7,13H,4-5,8-12H2,(H,16,17) |
| InChIKey | KGYFNYSDSVFQBZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|