C16H21Cl2NO3S — CID 110617365
3-(3,4-dichlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide (PubChem CID 110617365) has the molecular formula C16H21Cl2NO3S and a molecular weight of 378.32 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 110617365 |
| Molecular Formula | C16H21Cl2NO3S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)c(Cl)c1)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21Cl2NO3S/c17-14-5-3-12(10-15(14)18)4-6-16(20)19-8-1-2-13-7-9-23(21,22)11-13/h3,5,10,13H,1-2,4,6-9,11H2,(H,19,20) |
| InChIKey | ZXYIVBSVXDTMOF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|