C13H18N2O3S — CID 110418925
N-[3-(1,1-dioxothiolan-3-yl)propyl]pyridine-4-carboxamide (PubChem CID 110418925) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110418925 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)c1ccncc1 |
| InChI | InChI=1S/C13H18N2O3S/c16-13(12-3-7-14-8-4-12)15-6-1-2-11-5-9-19(17,18)10-11/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,15,16) |
| InChIKey | PIYREDPMUMBYKB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|