C16H24ClNO2S — CID 62528648
3-(2-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine (PubChem CID 62528648) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine.
| Compound Name | 3-(2-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62528648 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(2-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1ccccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-2-8-18-11-15(14-7-9-21(19,20)12-14)10-13-5-3-4-6-16(13)17/h3-6,14-15,18H,2,7-12H2,1H3 |
| InChIKey | FAOCRGYBMQUHPY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|