C14H27NO3S — CID 106930577
3-(cyclopropylmethoxy)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine (PubChem CID 106930577) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine.
| Compound Name | 3-(cyclopropylmethoxy)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 106930577 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-(cyclopropylmethoxy)-2-(1,1-dioxothiolan-3-yl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(COCC1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H27NO3S/c1-2-6-15-8-14(10-18-9-12-3-4-12)13-5-7-19(16,17)11-13/h12-15H,2-11H2,1H3 |
| InChIKey | ZKGUGQJLOVGCLG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|