C15H31NO4S — CID 62724977
4-butoxy-2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)butan-1-amine (PubChem CID 62724977) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is 4-butoxy-2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-butoxy-2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 62724977 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-butoxy-2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)butan-1-amine |
| SMILES | CCCCOCCC(CNCCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H31NO4S/c1-3-4-8-20-9-5-14(12-16-7-10-19-2)15-6-11-21(17,18)13-15/h14-16H,3-13H2,1-2H3 |
| InChIKey | PHSURMKPNGBRDK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|