C17H35NO2S — CID 62530642
2-(1,1-dioxothiolan-3-yl)-4-ethyl-N-propyloctan-1-amine (PubChem CID 62530642) has the molecular formula C17H35NO2S and a molecular weight of 317.54 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4-ethyl-N-propyloctan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-4-ethyl-N-propyloctan-1-amine |
|---|---|
| PubChem CID | 62530642 |
| Molecular Formula | C17H35NO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-4-ethyl-N-propyloctan-1-amine |
| SMILES | CCCCC(CC)CC(CNCCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H35NO2S/c1-4-7-8-15(6-3)12-17(13-18-10-5-2)16-9-11-21(19,20)14-16/h15-18H,4-14H2,1-3H3 |
| InChIKey | PDYSRFQTTKKOIP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|