C12H24O3S — CID 51410709
(3S)-3-[(2R)-2-ethylhexoxy]thiolane 1,1-dioxide (PubChem CID 51410709) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is (3S)-3-[(2R)-2-ethylhexoxy]thiolane 1,1-dioxide.
| Compound Name | (3S)-3-[(2R)-2-ethylhexoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 51410709 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3S)-3-[(2R)-2-ethylhexoxy]thiolane 1,1-dioxide |
| SMILES | CCCCC(CC)CO[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24O3S/c1-3-5-6-11(4-2)9-15-12-7-8-16(13,14)10-12/h11-12H,3-10H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | QVNCMGGYBIYJIG-KIYNQFGBSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |