C14H29NO3S — CID 55092912
N-[2-(2-ethylhexoxy)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 55092912) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N-[2-(2-ethylhexoxy)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2-(2-ethylhexoxy)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 55092912 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[2-(2-ethylhexoxy)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCCCC(CC)COCCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H29NO3S/c1-3-5-6-13(4-2)11-18-9-8-15-14-7-10-19(16,17)12-14/h13-15H,3-12H2,1-2H3 |
| InChIKey | WXOISKYQWXCVGX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|