C9H17F2NO3S — CID 103082697
N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxothian-3-amine (PubChem CID 103082697) has the molecular formula C9H17F2NO3S and a molecular weight of 257.30 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 103082697 |
| Molecular Formula | C9H17F2NO3S |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCCOCC(F)F)C1 |
| InChI | InChI=1S/C9H17F2NO3S/c10-9(11)6-15-4-3-12-8-2-1-5-16(13,14)7-8/h8-9,12H,1-7H2 |
| InChIKey | QRZZPJFZGLBUHN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|