C10H19NO2S — CID 114472310
N-(3-methylbut-3-enyl)-1,1-dioxothian-3-amine (PubChem CID 114472310) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(3-methylbut-3-enyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(3-methylbut-3-enyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 114472310 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(3-methylbut-3-enyl)-1,1-dioxothian-3-amine |
| SMILES | C=C(C)CCNC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-9(2)5-6-11-10-4-3-7-14(12,13)8-10/h10-11H,1,3-8H2,2H3 |
| InChIKey | TZRBQEXZCIHNGI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|