C15H31NO2S — CID 62529457
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-methylhexan-1-amine (PubChem CID 62529457) has the molecular formula C15H31NO2S and a molecular weight of 289.48 g/mol. Its IUPAC name is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-methylhexan-1-amine.
| Compound Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-methylhexan-1-amine |
|---|---|
| PubChem CID | 62529457 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-methylhexan-1-amine |
| SMILES | CCC(C)CC(CNC(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H31NO2S/c1-6-12(2)9-14(10-16-15(3,4)5)13-7-8-19(17,18)11-13/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | ARZBAALCYFZRCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |