C11H23NO2S — CID 83139103
2-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutan-1-amine (PubChem CID 83139103) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 83139103 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutan-1-amine |
| SMILES | CNCC(C1CCS(=O)(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-11(2,3)10(7-12-4)9-5-6-15(13,14)8-9/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | WJNBUXQMQNDUEL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |