C12H25NO3S — CID 113437124
2-(1,1-dioxothiolan-3-yl)-6-methoxy-N-methylhexan-1-amine (PubChem CID 113437124) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-6-methoxy-N-methylhexan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-6-methoxy-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 113437124 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-6-methoxy-N-methylhexan-1-amine |
| SMILES | CNCC(CCCCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H25NO3S/c1-13-9-11(5-3-4-7-16-2)12-6-8-17(14,15)10-12/h11-13H,3-10H2,1-2H3 |
| InChIKey | MXKMLVUYVNFCSF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|