C11H22O5S — CID 66024520
2-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)butan-1-ol (PubChem CID 66024520) has the molecular formula C11H22O5S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)butan-1-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)butan-1-ol |
|---|---|
| PubChem CID | 66024520 |
| Molecular Formula | C11H22O5S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)butan-1-ol |
| SMILES | COCCOCCC(CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22O5S/c1-15-5-6-16-4-2-10(8-12)11-3-7-17(13,14)9-11/h10-12H,2-9H2,1H3 |
| InChIKey | UDZHXAMSRQTXMN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|