C11H22O4S — CID 106459418
2-(1,1-dioxothiolan-3-yl)-4-propoxybutan-1-ol (PubChem CID 106459418) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4-propoxybutan-1-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-4-propoxybutan-1-ol |
|---|---|
| PubChem CID | 106459418 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-4-propoxybutan-1-ol |
| SMILES | CCCOCCC(CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22O4S/c1-2-5-15-6-3-10(8-12)11-4-7-16(13,14)9-11/h10-12H,2-9H2,1H3 |
| InChIKey | FKZJUUGURFZICO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|