C13H22F3NO3S — CID 62530860
N-[2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butyl]cyclopropanamine (PubChem CID 62530860) has the molecular formula C13H22F3NO3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butyl]cyclopropanamine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 62530860 |
| Molecular Formula | C13H22F3NO3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butyl]cyclopropanamine |
| SMILES | O=S1(=O)CCC(C(CCOCC(F)(F)F)CNC2CC2)C1 |
| InChI | InChI=1S/C13H22F3NO3S/c14-13(15,16)9-20-5-3-10(7-17-12-1-2-12)11-4-6-21(18,19)8-11/h10-12,17H,1-9H2 |
| InChIKey | JBZYNEVJGPFMAI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|