C14H27NO4S — CID 62725175
2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-3-(oxolan-2-yl)propan-1-amine (PubChem CID 62725175) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 62725175 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-3-(oxolan-2-yl)propan-1-amine |
| SMILES | COCCNCC(CC1CCCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H27NO4S/c1-18-7-5-15-10-13(9-14-3-2-6-19-14)12-4-8-20(16,17)11-12/h12-15H,2-11H2,1H3 |
| InChIKey | HAUYHCLDZQIMOC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|