C11H20O4S — CID 115336434
1-(1,1-dioxothiolan-3-yl)-3-(oxolan-2-yl)propan-1-ol (PubChem CID 115336434) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-2-yl)propan-1-ol.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 115336434 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-2-yl)propan-1-ol |
| SMILES | O=S1(=O)CCC(C(O)CCC2CCCO2)C1 |
| InChI | InChI=1S/C11H20O4S/c12-11(4-3-10-2-1-6-15-10)9-5-7-16(13,14)8-9/h9-12H,1-8H2 |
| InChIKey | ZKSDQETYCMGKFZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |