C10H16O3S — CID 104804177
1-(1,1-dioxothiolan-3-yl)hex-4-yn-1-ol (PubChem CID 104804177) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)hex-4-yn-1-ol.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 104804177 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16O3S/c1-2-3-4-5-10(11)9-6-7-14(12,13)8-9/h9-11H,4-8H2,1H3 |
| InChIKey | GUDOUQJTBDORFV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|