C11H17NO3S — CID 115977379
2-(1,1-dioxothiolan-3-yl)-N-pent-3-ynylacetamide (PubChem CID 115977379) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-pent-3-ynylacetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-pent-3-ynylacetamide |
|---|---|
| PubChem CID | 115977379 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-pent-3-ynylacetamide |
| SMILES | CC#CCCNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO3S/c1-2-3-4-6-12-11(13)8-10-5-7-16(14,15)9-10/h10H,4-9H2,1H3,(H,12,13) |
| InChIKey | UCZNLOYRQZYDJL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|