C12H23NO4S — CID 65114161
2-(1,1-dioxothiolan-3-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide (PubChem CID 65114161) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide |
|---|---|
| PubChem CID | 65114161 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide |
| SMILES | CCC(O)(CC)CNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23NO4S/c1-3-12(15,4-2)9-13-11(14)7-10-5-6-18(16,17)8-10/h10,15H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | RIFAFLQTYBFJEB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |