C13H23NO2S — CID 113455496
1-(1,1-dioxothiolan-3-yl)-N-propylhex-4-yn-1-amine (PubChem CID 113455496) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-propylhex-4-yn-1-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-propylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 113455496 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-propylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23NO2S/c1-3-5-6-7-13(14-9-4-2)12-8-10-17(15,16)11-12/h12-14H,4,6-11H2,1-2H3 |
| InChIKey | WJDWXKRMWNXTRH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|