C19H27N — CID 104806170
N-propyl-1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-amine (PubChem CID 104806170) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-propyl-1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-amine.
| Compound Name | N-propyl-1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-amine |
|---|---|
| PubChem CID | 104806170 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-propyl-1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-amine |
| SMILES | CC#CCCC(NCCC)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H27N/c1-3-5-6-11-19(20-14-4-2)18-13-12-16-9-7-8-10-17(16)15-18/h7-10,18-20H,4,6,11-15H2,1-2H3 |
| InChIKey | WIVFUGUJQFDAQY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|