C16H20O — CID 104803923
1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-ol (PubChem CID 104803923) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-ol.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 104803923 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H20O/c1-2-3-4-9-16(17)15-11-10-13-7-5-6-8-14(13)12-15/h5-8,15-17H,4,9-12H2,1H3 |
| InChIKey | JPRSEVARHJMQSW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|